C19H26N4OS — CID 131913701
(E)-3-(1,3-benzothiazol-2-yl)-N-[2-(4-methylpiperazin-1-yl)butyl]prop-2-enamide (PubChem CID 131913701) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(4-methylpiperazin-1-yl)butyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(4-methylpiperazin-1-yl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 131913701 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(4-methylpiperazin-1-yl)butyl]prop-2-enamide |
| SMILES | CCC(CNC(=O)/C=C/c1nc2ccccc2s1)N1CCN(C)CC1 |
| InChI | InChI=1S/C19H26N4OS/c1-3-15(23-12-10-22(2)11-13-23)14-20-18(24)8-9-19-21-16-6-4-5-7-17(16)25-19/h4-9,15H,3,10-14H2,1-2H3,(H,20,24)/b9-8+ |
| InChIKey | XBUQOEPSAGTKND-CMDGGOBGSA-N |
| XLogP | 2.45 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|