C22H25N3OS — CID 97359697
(Z)-3-(1,3-benzothiazol-2-yl)-N-[(2R)-2-(diethylamino)-2-phenylethyl]prop-2-enamide (PubChem CID 97359697) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is (Z)-3-(1,3-benzothiazol-2-yl)-N-[(2R)-2-(diethylamino)-2-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzothiazol-2-yl)-N-[(2R)-2-(diethylamino)-2-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 97359697 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (Z)-3-(1,3-benzothiazol-2-yl)-N-[(2R)-2-(diethylamino)-2-phenylethyl]prop-2-enamide |
| SMILES | CCN(CC)[C@@H](CNC(=O)/C=C\c1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3OS/c1-3-25(4-2)19(17-10-6-5-7-11-17)16-23-21(26)14-15-22-24-18-12-8-9-13-20(18)27-22/h5-15,19H,3-4,16H2,1-2H3,(H,23,26)/b15-14-/t19-/m0/s1 |
| InChIKey | WGJBOPYCNLSSOE-AVCMKVNGSA-N |
| XLogP | 4.51 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|