C25H30N4OS — CID 55671455
(E)-3-(1,3-benzothiazol-2-yl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]prop-2-enamide (PubChem CID 55671455) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]prop-2-enamide |
|---|---|
| PubChem CID | 55671455 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]prop-2-enamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)/C=C/c3nc4ccccc4s3)CC2)c1 |
| InChI | InChI=1S/C25H30N4OS/c1-20-7-6-8-21(19-20)29-17-15-28(16-18-29)14-5-4-13-26-24(30)11-12-25-27-22-9-2-3-10-23(22)31-25/h2-3,6-12,19H,4-5,13-18H2,1H3,(H,26,30)/b12-11+ |
| InChIKey | PLCMXFNBBSTBSQ-VAWYXSNFSA-N |
| XLogP | 4.34 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|