C17H18N4OS — CID 56789537
(E)-3-(1,3-benzothiazol-2-yl)-N-(4-imidazol-1-ylbutyl)prop-2-enamide (PubChem CID 56789537) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-(4-imidazol-1-ylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(4-imidazol-1-ylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 56789537 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-(4-imidazol-1-ylbutyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)NCCCCn1ccnc1 |
| InChI | InChI=1S/C17H18N4OS/c22-16(19-9-3-4-11-21-12-10-18-13-21)7-8-17-20-14-5-1-2-6-15(14)23-17/h1-2,5-8,10,12-13H,3-4,9,11H2,(H,19,22)/b8-7+ |
| InChIKey | UHXTZHKQYCCFFO-BQYQJAHWSA-N |
| XLogP | 3.10 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|