C22H20N4OS — CID 166195199
(E)-N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(4-imidazol-1-ylphenyl)prop-2-enamide (PubChem CID 166195199) has the molecular formula C22H20N4OS and a molecular weight of 388.50 g/mol. Its IUPAC name is (E)-N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(4-imidazol-1-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(4-imidazol-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 166195199 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (E)-N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(4-imidazol-1-ylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-n2ccnc2)cc1)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H20N4OS/c27-21(12-9-17-7-10-18(11-8-17)26-15-14-23-16-26)24-13-3-6-22-25-19-4-1-2-5-20(19)28-22/h1-2,4-5,7-12,14-16H,3,6,13H2,(H,24,27)/b12-9+ |
| InChIKey | KKLWSDCVCBKYEG-FMIVXFBMSA-N |
| XLogP | 4.24 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|