C17H13ClN4OS2 — CID 86907335
(E)-N-[2-(1,3-benzothiazol-2-yl)ethyl]-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide (PubChem CID 86907335) has the molecular formula C17H13ClN4OS2 and a molecular weight of 388.91 g/mol. Its IUPAC name is (E)-N-[2-(1,3-benzothiazol-2-yl)ethyl]-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(1,3-benzothiazol-2-yl)ethyl]-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 86907335 |
| Molecular Formula | C17H13ClN4OS2 |
| Molecular Weight | 388.91 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | (E)-N-[2-(1,3-benzothiazol-2-yl)ethyl]-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H13ClN4OS2/c18-16-12(22-9-10-24-17(22)21-16)5-6-14(23)19-8-7-15-20-11-3-1-2-4-13(11)25-15/h1-6,9-10H,7-8H2,(H,19,23)/b6-5+ |
| InChIKey | QLNAJXCEFXZSSC-AATRIKPKSA-N |
| XLogP | 4.03 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|