C15H16N2OS — CID 51296692
(2E,4E)-N-[2-(1,3-benzothiazol-2-yl)ethyl]hexa-2,4-dienamide (PubChem CID 51296692) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is (2E,4E)-N-[2-(1,3-benzothiazol-2-yl)ethyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[2-(1,3-benzothiazol-2-yl)ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 51296692 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2E,4E)-N-[2-(1,3-benzothiazol-2-yl)ethyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H16N2OS/c1-2-3-4-9-14(18)16-11-10-15-17-12-7-5-6-8-13(12)19-15/h2-9H,10-11H2,1H3,(H,16,18)/b3-2+,9-4+ |
| InChIKey | XRNSDDQLXUNSHM-DSXPNFDZSA-N |
| XLogP | 3.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|