C14H14FN3O — CID 90264827
(E)-3-(2-fluorophenyl)-N-(2-imidazol-1-ylethyl)prop-2-enamide (PubChem CID 90264827) has the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-(2-imidazol-1-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-N-(2-imidazol-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 90264827 |
| Molecular Formula | C14H14FN3O |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-(2-imidazol-1-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1F)NCCn1ccnc1 |
| InChI | InChI=1S/C14H14FN3O/c15-13-4-2-1-3-12(13)5-6-14(19)17-8-10-18-9-7-16-11-18/h1-7,9,11H,8,10H2,(H,17,19)/b6-5+ |
| InChIKey | HGCQLQHFWCAXER-AATRIKPKSA-N |
| XLogP | 1.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|