C15H17N3O2 — CID 176908605
(E)-3-(2-hydroxyphenyl)-N-(3-imidazol-1-ylpropyl)prop-2-enamide (PubChem CID 176908605) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (E)-3-(2-hydroxyphenyl)-N-(3-imidazol-1-ylpropyl)prop-2-enamide.
| Compound Name | (E)-3-(2-hydroxyphenyl)-N-(3-imidazol-1-ylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 176908605 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (E)-3-(2-hydroxyphenyl)-N-(3-imidazol-1-ylpropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1O)NCCCn1ccnc1 |
| InChI | InChI=1S/C15H17N3O2/c19-14-5-2-1-4-13(14)6-7-15(20)17-8-3-10-18-11-9-16-12-18/h1-2,4-7,9,11-12,19H,3,8,10H2,(H,17,20)/b7-6+ |
| InChIKey | CZWAMXJXYMSXKI-VOTSOKGWSA-N |
| XLogP | 1.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|