C16H19N3O2 — CID 27397163
(E)-N-(3-imidazol-1-ylpropyl)-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 27397163) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is (E)-N-(3-imidazol-1-ylpropyl)-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-imidazol-1-ylpropyl)-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 27397163 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (E)-N-(3-imidazol-1-ylpropyl)-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NCCCn2ccnc2)c1 |
| InChI | InChI=1S/C16H19N3O2/c1-21-15-5-2-4-14(12-15)6-7-16(20)18-8-3-10-19-11-9-17-13-19/h2,4-7,9,11-13H,3,8,10H2,1H3,(H,18,20)/b7-6+ |
| InChIKey | UFNIJZZEQNFMQB-VOTSOKGWSA-N |
| XLogP | 2.11 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|