C23H34N4O — CID 18349565
(E)-3-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]-N-pentylprop-2-enamide (PubChem CID 18349565) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is (E)-3-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]-N-pentylprop-2-enamide.
| Compound Name | (E)-3-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]-N-pentylprop-2-enamide |
|---|---|
| PubChem CID | 18349565 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (E)-3-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]-N-pentylprop-2-enamide |
| SMILES | CCCCCNC(=O)/C=C/c1ccc(C(C)(C)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C23H34N4O/c1-4-5-6-14-25-22(28)13-10-20-8-11-21(12-9-20)23(2,3)26-15-7-17-27-18-16-24-19-27/h8-13,16,18-19,26H,4-7,14-15,17H2,1-3H3,(H,25,28)/b13-10+ |
| InChIKey | POWQZZYETBCSIP-JLHYYAGUSA-N |
| XLogP | 4.12 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|