C20H29N3O2 — CID 19429473
[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl] pentanoate (PubChem CID 19429473) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is [4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl] pentanoate.
| Compound Name | [4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl] pentanoate |
|---|---|
| PubChem CID | 19429473 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | [4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(C(C)(C)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C20H29N3O2/c1-4-5-7-19(24)25-18-10-8-17(9-11-18)20(2,3)22-12-6-14-23-15-13-21-16-23/h8-11,13,15-16,22H,4-7,12,14H2,1-3H3 |
| InChIKey | KFJVZKCUFOJTNU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|