C21H33N3O2 — CID 18349648
1-[5-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]-2-methoxyphenyl]pentan-1-ol (PubChem CID 18349648) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-[5-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]-2-methoxyphenyl]pentan-1-ol.
| Compound Name | 1-[5-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]-2-methoxyphenyl]pentan-1-ol |
|---|---|
| PubChem CID | 18349648 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 1-[5-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]-2-methoxyphenyl]pentan-1-ol |
| SMILES | CCCCC(O)c1cc(C(C)(C)NCCCn2ccnc2)ccc1OC |
| InChI | InChI=1S/C21H33N3O2/c1-5-6-8-19(25)18-15-17(9-10-20(18)26-4)21(2,3)23-11-7-13-24-14-12-22-16-24/h9-10,12,14-16,19,23,25H,5-8,11,13H2,1-4H3 |
| InChIKey | GQRVKUALPHVDRQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|