C22H29Cl2N3O — CID 18349638
N-(3-imidazol-1-ylpropyl)-2-(4-phenylmethoxyphenyl)propan-2-amine;dihydrochloride (PubChem CID 18349638) has the molecular formula C22H29Cl2N3O and a molecular weight of 422.40 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-(4-phenylmethoxyphenyl)propan-2-amine;dihydrochloride.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-(4-phenylmethoxyphenyl)propan-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 18349638 |
| Molecular Formula | C22H29Cl2N3O |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-(4-phenylmethoxyphenyl)propan-2-amine;dihydrochloride |
| SMILES | CC(C)(NCCCn1ccnc1)c1ccc(OCc2ccccc2)cc1.Cl.Cl |
| InChI | InChI=1S/C22H27N3O.2ClH/c1-22(2,24-13-6-15-25-16-14-23-18-25)20-9-11-21(12-10-20)26-17-19-7-4-3-5-8-19;;/h3-5,7-12,14,16,18,24H,6,13,15,17H2,1-2H3;2*1H |
| InChIKey | ABPYJVOHDAHOFP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|