C20H29N3O2 — CID 67612775
2-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]pentanoic acid (PubChem CID 67612775) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]pentanoic acid.
| Compound Name | 2-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 67612775 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1ccc(C(C)(C)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C20H29N3O2/c1-4-6-18(19(24)25)16-7-9-17(10-8-16)20(2,3)22-11-5-13-23-14-12-21-15-23/h7-10,12,14-15,18,22H,4-6,11,13H2,1-3H3,(H,24,25) |
| InChIKey | NXJSUEXSLDFUKP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|