C20H31N3O2S — CID 18349544
1-(4-tert-butylphenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)-2-methylpropan-2-amine (PubChem CID 18349544) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)-2-methylpropan-2-amine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 18349544 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)-2-methylpropan-2-amine |
| SMILES | CC(C)(CS(=O)(=O)c1ccc(C(C)(C)C)cc1)NCCCn1ccnc1 |
| InChI | InChI=1S/C20H31N3O2S/c1-19(2,3)17-7-9-18(10-8-17)26(24,25)15-20(4,5)22-11-6-13-23-14-12-21-16-23/h7-10,12,14,16,22H,6,11,13,15H2,1-5H3 |
| InChIKey | UDAZLRWEJJPFHZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|