C19H29N3O2S — CID 166360372
N-[2-(4-tert-butylphenyl)-2-methylpropyl]-2-imidazol-1-ylethanesulfonamide (PubChem CID 166360372) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-2-methylpropyl]-2-imidazol-1-ylethanesulfonamide.
| Compound Name | N-[2-(4-tert-butylphenyl)-2-methylpropyl]-2-imidazol-1-ylethanesulfonamide |
|---|---|
| PubChem CID | 166360372 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-2-methylpropyl]-2-imidazol-1-ylethanesulfonamide |
| SMILES | CC(C)(C)c1ccc(C(C)(C)CNS(=O)(=O)CCn2ccnc2)cc1 |
| InChI | InChI=1S/C19H29N3O2S/c1-18(2,3)16-6-8-17(9-7-16)19(4,5)14-21-25(23,24)13-12-22-11-10-20-15-22/h6-11,15,21H,12-14H2,1-5H3 |
| InChIKey | IAHNPXWKTOMOEZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |