C25H33N5O3S — CID 18349778
4-[2-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]ethylsulfamoyl]-N-methylbenzamide (PubChem CID 18349778) has the molecular formula C25H33N5O3S and a molecular weight of 483.64 g/mol. Its IUPAC name is 4-[2-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]ethylsulfamoyl]-N-methylbenzamide.
| Compound Name | 4-[2-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]ethylsulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 18349778 |
| Molecular Formula | C25H33N5O3S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-[2-[4-[2-(3-imidazol-1-ylpropylamino)propan-2-yl]phenyl]ethylsulfamoyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)NCCc2ccc(C(C)(C)NCCCn3ccnc3)cc2)cc1 |
| InChI | InChI=1S/C25H33N5O3S/c1-25(2,28-14-4-17-30-18-16-27-19-30)22-9-5-20(6-10-22)13-15-29-34(32,33)23-11-7-21(8-12-23)24(31)26-3/h5-12,16,18-19,28-29H,4,13-15,17H2,1-3H3,(H,26,31) |
| InChIKey | RMPOYQWRDUMKMO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|