C12H17N5O2S — CID 43455140
4-hydrazinyl-N-(3-imidazol-1-ylpropyl)benzenesulfonamide (PubChem CID 43455140) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is 4-hydrazinyl-N-(3-imidazol-1-ylpropyl)benzenesulfonamide.
| Compound Name | 4-hydrazinyl-N-(3-imidazol-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43455140 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-hydrazinyl-N-(3-imidazol-1-ylpropyl)benzenesulfonamide |
| SMILES | NNc1ccc(S(=O)(=O)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C12H17N5O2S/c13-16-11-2-4-12(5-3-11)20(18,19)15-6-1-8-17-9-7-14-10-17/h2-5,7,9-10,15-16H,1,6,8,13H2 |
| InChIKey | XMIICICDJLWJDL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|