C14H17N3O3S — CID 51072939
N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 51072939) has the molecular formula C14H17N3O3S and a molecular weight of 307.37 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 51072939 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | O=S(=O)(NCCCn1ccnc1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H17N3O3S/c18-21(19,16-5-1-7-17-8-6-15-11-17)13-2-3-14-12(10-13)4-9-20-14/h2-3,6,8,10-11,16H,1,4-5,7,9H2 |
| InChIKey | LKVQOCADOJHWMJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|