C15H18N4O5S2 — CID 22694453
N-(3-imidazol-1-ylpropyl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide (PubChem CID 22694453) has the molecular formula C15H18N4O5S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22694453 |
| Molecular Formula | C15H18N4O5S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
| SMILES | O=C1CCS(=O)(=O)N1c1ccc(S(=O)(=O)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C15H18N4O5S2/c20-15-6-11-25(21,22)19(15)13-2-4-14(5-3-13)26(23,24)17-7-1-9-18-10-8-16-12-18/h2-5,8,10,12,17H,1,6-7,9,11H2 |
| InChIKey | UCRJTSXEPATPHB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|