C28H31N3O — CID 18349622
N-(3-imidazol-1-ylpropyl)-2-[4-(4-phenylmethoxyphenyl)phenyl]propan-2-amine (PubChem CID 18349622) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-[4-(4-phenylmethoxyphenyl)phenyl]propan-2-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-[4-(4-phenylmethoxyphenyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 18349622 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-[4-(4-phenylmethoxyphenyl)phenyl]propan-2-amine |
| SMILES | CC(C)(NCCCn1ccnc1)c1ccc(-c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H31N3O/c1-28(2,30-17-6-19-31-20-18-29-22-31)26-13-9-24(10-14-26)25-11-15-27(16-12-25)32-21-23-7-4-3-5-8-23/h3-5,7-16,18,20,22,30H,6,17,19,21H2,1-2H3 |
| InChIKey | LTKSTPZQWLEODE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|