C11H9NS — CID 21425799
2-[(1E)-buta-1,3-dienyl]-1,3-benzothiazole (PubChem CID 21425799) has the molecular formula C11H9NS and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-[(1E)-buta-1,3-dienyl]-1,3-benzothiazole.
| Compound Name | 2-[(1E)-buta-1,3-dienyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 21425799 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2-[(1E)-buta-1,3-dienyl]-1,3-benzothiazole |
| SMILES | C=C/C=C/c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H9NS/c1-2-3-8-11-12-9-6-4-5-7-10(9)13-11/h2-8H,1H2/b8-3+ |
| InChIKey | GYMSRTFPLLSJBE-FPYGCLRLSA-N |
| XLogP | 3.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|