C13H10N2S — CID 11790904
2-[(E)-2-(1H-pyrrol-2-yl)ethenyl]-1,3-benzothiazole (PubChem CID 11790904) has the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-[(E)-2-(1H-pyrrol-2-yl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(1H-pyrrol-2-yl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 11790904 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-[(E)-2-(1H-pyrrol-2-yl)ethenyl]-1,3-benzothiazole |
| SMILES | C(=C/c1nc2ccccc2s1)\c1ccc[nH]1 |
| InChI | InChI=1S/C13H10N2S/c1-2-6-12-11(5-1)15-13(16-12)8-7-10-4-3-9-14-10/h1-9,14H/b8-7+ |
| InChIKey | GJRBQWVNDXPHBL-BQYQJAHWSA-N |
| XLogP | 3.79 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |