C10H10N2OS — CID 142937013
N-[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enyl]hydroxylamine (PubChem CID 142937013) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is N-[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enyl]hydroxylamine.
| Compound Name | N-[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enyl]hydroxylamine |
|---|---|
| PubChem CID | 142937013 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | N-[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enyl]hydroxylamine |
| SMILES | ONC/C=C/c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H10N2OS/c13-11-7-3-6-10-12-8-4-1-2-5-9(8)14-10/h1-6,11,13H,7H2/b6-3+ |
| InChIKey | NEOVQLYNIOZACD-ZZXKWVIFSA-N |
| XLogP | 2.29 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|