C12H13NS2 — CID 154089216
2-(2-methylsulfanylbut-1-enyl)-1,3-benzothiazole (PubChem CID 154089216) has the molecular formula C12H13NS2 and a molecular weight of 235.38 g/mol. Its IUPAC name is 2-(2-methylsulfanylbut-1-enyl)-1,3-benzothiazole.
| Compound Name | 2-(2-methylsulfanylbut-1-enyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 154089216 |
| Molecular Formula | C12H13NS2 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-(2-methylsulfanylbut-1-enyl)-1,3-benzothiazole |
| SMILES | CCC(=Cc1nc2ccccc2s1)SC |
| InChI | InChI=1S/C12H13NS2/c1-3-9(14-2)8-12-13-10-6-4-5-7-11(10)15-12/h4-8H,3H2,1-2H3 |
| InChIKey | ASKXFFSMDYXORX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |