C26H23N3S2 — CID 3626172
4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-N,N-diethylaniline (PubChem CID 3626172) has the molecular formula C26H23N3S2 and a molecular weight of 441.63 g/mol. Its IUPAC name is 4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 3626172 |
| Molecular Formula | C26H23N3S2 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C=C(c2nc3ccccc3s2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C26H23N3S2/c1-3-29(4-2)19-15-13-18(14-16-19)17-20(25-27-21-9-5-7-11-23(21)30-25)26-28-22-10-6-8-12-24(22)31-26/h5-17H,3-4H2,1-2H3 |
| InChIKey | JVHQNHYDIKOKHI-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|