C28H17N3O2S2 — CID 4646251
[4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]phenyl] pyridine-3-carboxylate (PubChem CID 4646251) has the molecular formula C28H17N3O2S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is [4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]phenyl] pyridine-3-carboxylate.
| Compound Name | [4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 4646251 |
| Molecular Formula | C28H17N3O2S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | [4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]phenyl] pyridine-3-carboxylate |
| SMILES | O=C(Oc1ccc(C=C(c2nc3ccccc3s2)c2nc3ccccc3s2)cc1)c1cccnc1 |
| InChI | InChI=1S/C28H17N3O2S2/c32-28(19-6-5-15-29-17-19)33-20-13-11-18(12-14-20)16-21(26-30-22-7-1-3-9-24(22)34-26)27-31-23-8-2-4-10-25(23)35-27/h1-17H |
| InChIKey | ASSUOPWZIQGGTH-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|