C16H11NO3S — CID 22373846
[4-(1,3-benzothiazole-2-carbonyl)phenyl] acetate (PubChem CID 22373846) has the molecular formula C16H11NO3S and a molecular weight of 297.34 g/mol. Its IUPAC name is [4-(1,3-benzothiazole-2-carbonyl)phenyl] acetate.
| Compound Name | [4-(1,3-benzothiazole-2-carbonyl)phenyl] acetate |
|---|---|
| PubChem CID | 22373846 |
| Molecular Formula | C16H11NO3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | [4-(1,3-benzothiazole-2-carbonyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H11NO3S/c1-10(18)20-12-8-6-11(7-9-12)15(19)16-17-13-4-2-3-5-14(13)21-16/h2-9H,1H3 |
| InChIKey | MSQYOEFLROCZMA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|