C20H13N3O3S — CID 9043335
(4-acetylphenyl) 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate (PubChem CID 9043335) has the molecular formula C20H13N3O3S and a molecular weight of 375.41 g/mol. Its IUPAC name is (4-acetylphenyl) 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate.
| Compound Name | (4-acetylphenyl) 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 9043335 |
| Molecular Formula | C20H13N3O3S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (4-acetylphenyl) 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate |
| SMILES | CC(=O)c1ccc(OC(=O)c2nccnc2-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H13N3O3S/c1-12(24)13-6-8-14(9-7-13)26-20(25)18-17(21-10-11-22-18)19-23-15-4-2-3-5-16(15)27-19/h2-11H,1H3 |
| InChIKey | MRTWYEZBLRCFJP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|