C21H18IrN2O2S — CID 59638803
(Z)-4-hydroxypent-3-en-2-one;iridium;2-isoquinolin-1-yl-1,3-benzothiazole (PubChem CID 59638803) has the molecular formula C21H18IrN2O2S and a molecular weight of 554.67 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-isoquinolin-1-yl-1,3-benzothiazole.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-isoquinolin-1-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 59638803 |
| Molecular Formula | C21H18IrN2O2S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-isoquinolin-1-yl-1,3-benzothiazole |
| SMILES | CC(=O)/C=C(/C)O.[Ir].c1ccc2c(-c3nc4ccccc4s3)nccc2c1 |
| InChI | InChI=1S/C16H10N2S.C5H8O2.Ir/c1-2-6-12-11(5-1)9-10-17-15(12)16-18-13-7-3-4-8-14(13)19-16;1-4(6)3-5(2)7;/h1-10H;3,6H,1-2H3;/b;4-3-; |
| InChIKey | XUHIJJLWJZJYRI-LWFKIUJUSA-N |
| XLogP | 5.55 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|