C16H16IrNO2S2- — CID 59227850
2-(3,4-dihydro-2H-thiophen-4-id-5-yl)-1,3-benzothiazole;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59227850) has the molecular formula C16H16IrNO2S2- and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-thiophen-4-id-5-yl)-1,3-benzothiazole;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-(3,4-dihydro-2H-thiophen-4-id-5-yl)-1,3-benzothiazole;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59227850 |
| Molecular Formula | C16H16IrNO2S2- |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 2-(3,4-dihydro-2H-thiophen-4-id-5-yl)-1,3-benzothiazole;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[C-]1=C(c2nc3ccccc3s2)SCC1.[Ir] |
| InChI | InChI=1S/C11H8NS2.C5H8O2.Ir/c1-2-5-9-8(4-1)12-11(14-9)10-6-3-7-13-10;1-4(6)3-5(2)7;/h1-2,4-5H,3,7H2;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | WVUZBUYZEHAWKE-LWFKIUJUSA-N |
| XLogP | 4.61 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|