C20H17IrN2O2S2- — CID 21030499
2-[(E)-1,3-benzothiazol-3-id-2-ylidenemethyl]-1,3-benzothiazole;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 21030499) has the molecular formula C20H17IrN2O2S2- and a molecular weight of 573.72 g/mol. Its IUPAC name is 2-[(E)-1,3-benzothiazol-3-id-2-ylidenemethyl]-1,3-benzothiazole;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-[(E)-1,3-benzothiazol-3-id-2-ylidenemethyl]-1,3-benzothiazole;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 21030499 |
| Molecular Formula | C20H17IrN2O2S2- |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | 2-[(E)-1,3-benzothiazol-3-id-2-ylidenemethyl]-1,3-benzothiazole;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | C(=C1\[N-]c2ccccc2S1)\c1nc2ccccc2s1.CC(=O)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C15H9N2S2.C5H8O2.Ir/c1-3-7-12-10(5-1)16-14(18-12)9-15-17-11-6-2-4-8-13(11)19-15;1-4(6)3-5(2)7;/h1-9H;3,6H,1-2H3;/q-1;;/b14-9+;4-3-; |
| InChIKey | JBBTWXSHHUYONY-PWHSIBMXSA-N |
| XLogP | 6.44 |
| TPSA | 64.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|