C30H25IrN2O2S- — CID 59428677
4-(1,3-benzothiazol-2-yl)-N,N-diphenylbenzene-5-id-1-amine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59428677) has the molecular formula C30H25IrN2O2S- and a molecular weight of 669.83 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N,N-diphenylbenzene-5-id-1-amine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N,N-diphenylbenzene-5-id-1-amine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59428677 |
| Molecular Formula | C30H25IrN2O2S- |
| Molecular Weight | 669.83 g/mol |
| Exact Mass | 670.13 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N,N-diphenylbenzene-5-id-1-amine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1cc(N(c2ccccc2)c2ccccc2)ccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H17N2S.C5H8O2.Ir/c1-3-9-20(10-4-1)27(21-11-5-2-6-12-21)22-17-15-19(16-18-22)25-26-23-13-7-8-14-24(23)28-25;1-4(6)3-5(2)7;/h1-15,17-18H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | UFAVNZZKJCCMJD-LWFKIUJUSA-N |
| XLogP | 8.27 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.83 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|