C24H28IrNO2Si- — CID 59022052
(Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[4-(3-methylquinolin-2-yl)benzene-5-id-1-yl]silane (PubChem CID 59022052) has the molecular formula C24H28IrNO2Si- and a molecular weight of 582.80 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[4-(3-methylquinolin-2-yl)benzene-5-id-1-yl]silane.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[4-(3-methylquinolin-2-yl)benzene-5-id-1-yl]silane |
|---|---|
| PubChem CID | 59022052 |
| Molecular Formula | C24H28IrNO2Si- |
| Molecular Weight | 582.80 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[4-(3-methylquinolin-2-yl)benzene-5-id-1-yl]silane |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc2ccccc2nc1-c1[c-]cc([Si](C)(C)C)cc1.[Ir] |
| InChI | InChI=1S/C19H20NSi.C5H8O2.Ir/c1-14-13-16-7-5-6-8-18(16)20-19(14)15-9-11-17(12-10-15)21(2,3)4;1-4(6)3-5(2)7;/h5-9,11-13H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | GSDKPHJCQXIVKB-LWFKIUJUSA-N |
| XLogP | 5.59 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.80 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|