C25H26IrNO3Si- — CID 161124870
[6-(3H-dibenzofuran-3-id-2-yl)-3-pyridinyl]-trimethylsilane;4-hydroxypent-3-en-2-one;iridium (PubChem CID 161124870) has the molecular formula C25H26IrNO3Si- and a molecular weight of 608.79 g/mol. Its IUPAC name is [6-(3H-dibenzofuran-3-id-2-yl)-3-pyridinyl]-trimethylsilane;4-hydroxypent-3-en-2-one;iridium.
| Compound Name | [6-(3H-dibenzofuran-3-id-2-yl)-3-pyridinyl]-trimethylsilane;4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 161124870 |
| Molecular Formula | C25H26IrNO3Si- |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | [6-(3H-dibenzofuran-3-id-2-yl)-3-pyridinyl]-trimethylsilane;4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)C=C(C)O.C[Si](C)(C)c1ccc(-c2[c-]cc3oc4ccccc4c3c2)nc1.[Ir] |
| InChI | InChI=1S/C20H18NOSi.C5H8O2.Ir/c1-23(2,3)15-9-10-18(21-13-15)14-8-11-20-17(12-14)16-6-4-5-7-19(16)22-20;1-4(6)3-5(2)7;/h4-7,9-13H,1-3H3;3,6H,1-2H3;/q-1;; |
| InChIKey | QLIICZUALYHRQE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|