C36H34IrNO3S- — CID 155626067
5-(3H-dibenzofuran-3-id-4-yl)-2-[3,5-di(propan-2-yl)phenyl]thieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 155626067) has the molecular formula C36H34IrNO3S- and a molecular weight of 752.96 g/mol. Its IUPAC name is 5-(3H-dibenzofuran-3-id-4-yl)-2-[3,5-di(propan-2-yl)phenyl]thieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 5-(3H-dibenzofuran-3-id-4-yl)-2-[3,5-di(propan-2-yl)phenyl]thieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 155626067 |
| Molecular Formula | C36H34IrNO3S- |
| Molecular Weight | 752.96 g/mol |
| Exact Mass | 753.19 |
| IUPAC Name | 5-(3H-dibenzofuran-3-id-4-yl)-2-[3,5-di(propan-2-yl)phenyl]thieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.CC(C)c1cc(-c2cc3cc(-c4[c-]ccc5c4oc4ccccc45)ncc3s2)cc(C(C)C)c1.[Ir] |
| InChI | InChI=1S/C31H26NOS.C5H8O2.Ir/c1-18(2)20-12-21(19(3)4)14-22(13-20)29-16-23-15-27(32-17-30(23)34-29)26-10-7-9-25-24-8-5-6-11-28(24)33-31(25)26;1-4(6)3-5(2)7;/h5-9,11-19H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | IOBCIDPGABHKKM-LWFKIUJUSA-N |
| XLogP | 10.61 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.96 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|