C38H39IrN2O3S- — CID 155629255
8-[2-(3,5-ditert-butylphenyl)thieno[2,3-b]pyridin-6-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 155629255) has the molecular formula C38H39IrN2O3S- and a molecular weight of 796.02 g/mol. Its IUPAC name is 8-[2-(3,5-ditert-butylphenyl)thieno[2,3-b]pyridin-6-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 8-[2-(3,5-ditert-butylphenyl)thieno[2,3-b]pyridin-6-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 155629255 |
| Molecular Formula | C38H39IrN2O3S- |
| Molecular Weight | 796.02 g/mol |
| Exact Mass | 796.23 |
| IUPAC Name | 8-[2-(3,5-ditert-butylphenyl)thieno[2,3-b]pyridin-6-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1ccc2c(n1)oc1c(-c3ccc4cc(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)sc4n3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C33H31N2OS.C5H8O2.Ir/c1-19-11-13-25-24-9-8-10-26(29(24)36-30(25)34-19)27-14-12-20-17-28(37-31(20)35-27)21-15-22(32(2,3)4)18-23(16-21)33(5,6)7;1-4(6)3-5(2)7;/h8-9,11-18H,1-7H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | WIDJRNAUNJZZNB-LWFKIUJUSA-N |
| XLogP | 10.66 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.02 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|