C38H31IrN2O4- — CID 155626077
8-[2-[4-(2,6-dimethylphenyl)phenyl]furo[3,2-c]pyridin-6-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 155626077) has the molecular formula C38H31IrN2O4- and a molecular weight of 771.89 g/mol. Its IUPAC name is 8-[2-[4-(2,6-dimethylphenyl)phenyl]furo[3,2-c]pyridin-6-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 8-[2-[4-(2,6-dimethylphenyl)phenyl]furo[3,2-c]pyridin-6-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 155626077 |
| Molecular Formula | C38H31IrN2O4- |
| Molecular Weight | 771.89 g/mol |
| Exact Mass | 772.19 |
| IUPAC Name | 8-[2-[4-(2,6-dimethylphenyl)phenyl]furo[3,2-c]pyridin-6-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1ccc2c(n1)oc1c(-c3cc4oc(-c5ccc(-c6c(C)cccc6C)cc5)cc4cn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C33H23N2O2.C5H8O2.Ir/c1-19-6-4-7-20(2)31(19)23-13-11-22(12-14-23)29-16-24-18-34-28(17-30(24)36-29)27-9-5-8-25-26-15-10-21(3)35-33(26)37-32(25)27;1-4(6)3-5(2)7;/h4-8,10-18H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | VOTRWJAOOXQFMI-LWFKIUJUSA-N |
| XLogP | 9.88 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.89 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|