C31H25IrN2O3S- — CID 155629187
(Z)-4-hydroxypent-3-en-2-one;iridium;2-methyl-8-[2-(4-methylphenyl)thieno[3,2-b]pyridin-5-yl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide (PubChem CID 155629187) has the molecular formula C31H25IrN2O3S- and a molecular weight of 697.84 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-methyl-8-[2-(4-methylphenyl)thieno[3,2-b]pyridin-5-yl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-methyl-8-[2-(4-methylphenyl)thieno[3,2-b]pyridin-5-yl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
|---|---|
| PubChem CID | 155629187 |
| Molecular Formula | C31H25IrN2O3S- |
| Molecular Weight | 697.84 g/mol |
| Exact Mass | 698.12 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-methyl-8-[2-(4-methylphenyl)thieno[3,2-b]pyridin-5-yl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
| SMILES | CC(=O)/C=C(/C)O.Cc1ccc(-c2cc3nc(-c4[c-]ccc5c4oc4nc(C)ccc45)ccc3s2)cc1.[Ir] |
| InChI | InChI=1S/C26H17N2OS.C5H8O2.Ir/c1-15-6-9-17(10-7-15)24-14-22-23(30-24)13-12-21(28-22)20-5-3-4-18-19-11-8-16(2)27-26(19)29-25(18)20;1-4(6)3-5(2)7;/h3-4,6-14H,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | DGBWJCAKKPBIDN-LWFKIUJUSA-N |
| XLogP | 8.38 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.84 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|