C25H28IrNO2- — CID 58871201
3,6-dimethyl-2-(2,3,4-trimethylbenzene-6-id-1-yl)quinoline;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 58871201) has the molecular formula C25H28IrNO2- and a molecular weight of 566.72 g/mol. Its IUPAC name is 3,6-dimethyl-2-(2,3,4-trimethylbenzene-6-id-1-yl)quinoline;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 3,6-dimethyl-2-(2,3,4-trimethylbenzene-6-id-1-yl)quinoline;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 58871201 |
| Molecular Formula | C25H28IrNO2- |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 3,6-dimethyl-2-(2,3,4-trimethylbenzene-6-id-1-yl)quinoline;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1ccc2nc(-c3[c-]cc(C)c(C)c3C)c(C)cc2c1.[Ir] |
| InChI | InChI=1S/C20H20N.C5H8O2.Ir/c1-12-6-9-19-17(10-12)11-14(3)20(21-19)18-8-7-13(2)15(4)16(18)5;1-4(6)3-5(2)7;/h6-7,9-11H,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | PZJCPOSYSMGHPX-LWFKIUJUSA-N |
| XLogP | 6.28 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|