C25H28IrNO3- — CID 58871183
(Z)-4-hydroxypent-3-en-2-one;iridium;6-methoxy-2-(2,3,4,5-tetramethylbenzene-6-id-1-yl)quinoline (PubChem CID 58871183) has the molecular formula C25H28IrNO3- and a molecular weight of 582.72 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;6-methoxy-2-(2,3,4,5-tetramethylbenzene-6-id-1-yl)quinoline.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;6-methoxy-2-(2,3,4,5-tetramethylbenzene-6-id-1-yl)quinoline |
|---|---|
| PubChem CID | 58871183 |
| Molecular Formula | C25H28IrNO3- |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;6-methoxy-2-(2,3,4,5-tetramethylbenzene-6-id-1-yl)quinoline |
| SMILES | CC(=O)/C=C(/C)O.COc1ccc2nc(-c3[c-]c(C)c(C)c(C)c3C)ccc2c1.[Ir] |
| InChI | InChI=1S/C20H20NO.C5H8O2.Ir/c1-12-10-18(15(4)14(3)13(12)2)20-8-6-16-11-17(22-5)7-9-19(16)21-20;1-4(6)3-5(2)7;/h6-9,11H,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | SDKRPSJTCVQQNA-LWFKIUJUSA-N |
| XLogP | 5.98 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|