C34H24IrNO2- — CID 160853516
3-(3H-anthracen-3-id-2-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;4-hydroxypent-3-en-2-one;iridium (PubChem CID 160853516) has the molecular formula C34H24IrNO2- and a molecular weight of 670.79 g/mol. Its IUPAC name is 3-(3H-anthracen-3-id-2-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 3-(3H-anthracen-3-id-2-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 160853516 |
| Molecular Formula | C34H24IrNO2- |
| Molecular Weight | 670.79 g/mol |
| Exact Mass | 671.14 |
| IUPAC Name | 3-(3H-anthracen-3-id-2-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)C=C(C)O.[Ir].[c-]1cc2cc3ccccc3cc2cc1-c1cc2c3c(cccc3n1)-c1ccccc1-2 |
| InChI | InChI=1S/C29H16N.C5H8O2.Ir/c1-2-7-19-15-22-16-21(13-12-20(22)14-18(19)6-1)28-17-26-24-9-4-3-8-23(24)25-10-5-11-27(30-28)29(25)26;1-4(6)3-5(2)7;/h1-12,14-17H;3,6H,1-2H3;/q-1;; |
| InChIKey | HDYKFLBYOPLHAV-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.79 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|