C35H28IrNO2- — CID 147243920
6-(4-ethenylphenyl)-4-hydroxyhex-3-en-2-one;iridium;3-phenyl-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene (PubChem CID 147243920) has the molecular formula C35H28IrNO2- and a molecular weight of 686.83 g/mol. Its IUPAC name is 6-(4-ethenylphenyl)-4-hydroxyhex-3-en-2-one;iridium;3-phenyl-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene.
| Compound Name | 6-(4-ethenylphenyl)-4-hydroxyhex-3-en-2-one;iridium;3-phenyl-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene |
|---|---|
| PubChem CID | 147243920 |
| Molecular Formula | C35H28IrNO2- |
| Molecular Weight | 686.83 g/mol |
| Exact Mass | 687.18 |
| IUPAC Name | 6-(4-ethenylphenyl)-4-hydroxyhex-3-en-2-one;iridium;3-phenyl-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene |
| SMILES | C=Cc1ccc(CCC(O)=CC(C)=O)cc1.[Ir].[c-]1ccccc1-c1cc2c3c(cccc3n1)-c1ccccc1-2 |
| InChI | InChI=1S/C21H12N.C14H16O2.Ir/c1-2-7-14(8-3-1)20-13-18-16-10-5-4-9-15(16)17-11-6-12-19(22-20)21(17)18;1-3-12-4-6-13(7-5-12)8-9-14(16)10-11(2)15;/h1-7,9-13H;3-7,10,16H,1,8-9H2,2H3;/q-1;; |
| InChIKey | GKTCSWFGKFPBGU-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.83 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|