C17H17IrNO2P- — CID 59517894
(Z)-4-hydroxy-5-[(6-phenyl-2-pyridinyl)methylphosphanyl]pent-3-en-2-one;iridium (PubChem CID 59517894) has the molecular formula C17H17IrNO2P- and a molecular weight of 490.52 g/mol. Its IUPAC name is (Z)-4-hydroxy-5-[(6-phenyl-2-pyridinyl)methylphosphanyl]pent-3-en-2-one;iridium.
| Compound Name | (Z)-4-hydroxy-5-[(6-phenyl-2-pyridinyl)methylphosphanyl]pent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59517894 |
| Molecular Formula | C17H17IrNO2P- |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | (Z)-4-hydroxy-5-[(6-phenyl-2-pyridinyl)methylphosphanyl]pent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(\O)CPCc1cccc(-c2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C17H17NO2P.Ir/c1-13(19)10-16(20)12-21-11-15-8-5-9-17(18-15)14-6-3-2-4-7-14;/h2-6,8-10,20-21H,11-12H2,1H3;/q-1;/b16-10+; |
| InChIKey | CCJDQOZAPWHGOX-QFHYWFJHSA-N |
| XLogP | 3.76 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|