About iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine
iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine (PubChem CID 59357334) has the molecular formula C17H17IrNO-2
and a molecular weight of 443.55 g/mol. Its IUPAC name is iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine.
Molecular Properties
| Compound Name | iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine |
| PubChem CID | 59357334 |
| Molecular Formula | C17H17IrNO-2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine |
| SMILES | [CH2-]/C(C)=C\C(C)=O.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.C6H9O.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-5(2)4-6(3)7;/h1-6,8-9H;4H,1H2,2-3H3;/q2*-1;/b;5-4+; |
| InChIKey | FIDYITPAAHKVQP-YHVJRZKVSA-N |
| XLogP | 3.90 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine?
The IUPAC name of iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine (CID 59357334) is iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine.
What is the SMILES notation for iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine?
The canonical SMILES for iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine is [CH2-]/C(C)=C\C(C)=O.[Ir].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine?
The InChIKey is FIDYITPAAHKVQP-YHVJRZKVSA-N. The full InChI is InChI=1S/C11H8N.C6H9O.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-5(2)4-6(3)7;/h1-6,8-9H;4H,1H2,2-3H3;/q2*-1;/b;5-4+;.
What are the key properties of iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine?
iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine has a molecular weight of 443.55 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;(E)-4-methanidylpent-3-en-2-one;2-phenylpyridine is sourced from PubChem (CID 59357334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).