About [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine (PubChem CID 58695341) has the molecular formula C16H17IrNO2
and a molecular weight of 447.53 g/mol. Its IUPAC name is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine.
Molecular Properties
| Compound Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine |
| PubChem CID | 58695341 |
| Molecular Formula | C16H17IrNO2 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine |
| SMILES | [H]/[O+]=C(C)/C=C(/C)O.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.C5H8O2.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-4(6)3-5(2)7;/h1-6,8-9H;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | CCVSHWGEJCJGEX-LWFKIUJUSA-O |
| XLogP | 3.56 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine?
The IUPAC name of [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine (CID 58695341) is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine.
What is the SMILES notation for [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine?
The canonical SMILES for [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine is [H]/[O+]=C(C)/C=C(/C)O.[Ir].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine?
The InChIKey is CCVSHWGEJCJGEX-LWFKIUJUSA-O. The full InChI is InChI=1S/C11H8N.C5H8O2.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-4(6)3-5(2)7;/h1-6,8-9H;3,6H,1-2H3;/q-1;;/p+1/b;4-3-;.
What are the key properties of [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine?
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine has a molecular weight of 447.53 g/mol, XLogP of 3.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenylpyridine is sourced from PubChem (CID 58695341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).