C19H20IrNO3- — CID 59517933
(Z)-4-hydroxy-6-methoxy-7-(6-phenyl-2-pyridinyl)hept-3-en-2-one;iridium (PubChem CID 59517933) has the molecular formula C19H20IrNO3- and a molecular weight of 502.59 g/mol. Its IUPAC name is (Z)-4-hydroxy-6-methoxy-7-(6-phenyl-2-pyridinyl)hept-3-en-2-one;iridium.
| Compound Name | (Z)-4-hydroxy-6-methoxy-7-(6-phenyl-2-pyridinyl)hept-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59517933 |
| Molecular Formula | C19H20IrNO3- |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | (Z)-4-hydroxy-6-methoxy-7-(6-phenyl-2-pyridinyl)hept-3-en-2-one;iridium |
| SMILES | COC(C/C(O)=C/C(C)=O)Cc1cccc(-c2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C19H20NO3.Ir/c1-14(21)11-17(22)13-18(23-2)12-16-9-6-10-19(20-16)15-7-4-3-5-8-15;/h3-7,9-11,18,22H,12-13H2,1-2H3;/q-1;/b17-11+; |
| InChIKey | JCAXJTBJLWHVFU-SJDTYFKWSA-N |
| XLogP | 3.52 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|