C33H28IrN — CID 140652480
iridium(3+);2-(2-methylpropyl)-6-phenylpyridine;3-phenyl-1-phenylbenzene-6-ide (PubChem CID 140652480) has the molecular formula C33H28IrN and a molecular weight of 630.81 g/mol. Its IUPAC name is iridium(3+);2-(2-methylpropyl)-6-phenylpyridine;3-phenyl-1-phenylbenzene-6-ide.
| Compound Name | iridium(3+);2-(2-methylpropyl)-6-phenylpyridine;3-phenyl-1-phenylbenzene-6-ide |
|---|---|
| PubChem CID | 140652480 |
| Molecular Formula | C33H28IrN |
| Molecular Weight | 630.81 g/mol |
| Exact Mass | 631.19 |
| IUPAC Name | iridium(3+);2-(2-methylpropyl)-6-phenylpyridine;3-phenyl-1-phenylbenzene-6-ide |
| SMILES | CC(C)Cc1cccc(-c2[c-]cccc2)n1.[Ir+3].[c-]1ccccc1-c1[c-]ccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H12.C15H16N.Ir/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;1-12(2)11-14-9-6-10-15(16-14)13-7-4-3-5-8-13;/h1-10,12,14H;3-7,9-10,12H,11H2,1-2H3;/q-2;-1;+3 |
| InChIKey | SJGPNYRETZDROK-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.81 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|