C37H28IrN — CID 162710622
1-(1-deuterio-1-phenylethyl)-3-phenylbenzene-4-ide;iridium(3+);2-(3-phenylbenzene-6-id-1-yl)pyridine (PubChem CID 162710622) has the molecular formula C37H28IrN and a molecular weight of 679.86 g/mol. Its IUPAC name is 1-(1-deuterio-1-phenylethyl)-3-phenylbenzene-4-ide;iridium(3+);2-(3-phenylbenzene-6-id-1-yl)pyridine.
| Compound Name | 1-(1-deuterio-1-phenylethyl)-3-phenylbenzene-4-ide;iridium(3+);2-(3-phenylbenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 162710622 |
| Molecular Formula | C37H28IrN |
| Molecular Weight | 679.86 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | 1-(1-deuterio-1-phenylethyl)-3-phenylbenzene-4-ide;iridium(3+);2-(3-phenylbenzene-6-id-1-yl)pyridine |
| SMILES | [2H]C(C)(c1ccccc1)c1cc[c-]c(-c2[c-]cccc2)c1.[Ir+3].[c-]1ccc(-c2ccccc2)cc1-c1ccccn1 |
| InChI | InChI=1S/C20H16.C17H12N.Ir/c1-16(17-9-4-2-5-10-17)19-13-8-14-20(15-19)18-11-6-3-7-12-18;1-2-7-14(8-3-1)15-9-6-10-16(13-15)17-11-4-5-12-18-17;/h2-11,13,15-16H,1H3;1-9,11-13H;/q-2;-1;+3/i16D;; |
| InChIKey | RHENELFIONSSOZ-DGSKOHBNSA-N |
| XLogP | 9.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.86 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|